C31H33ClN4O5 — CID 10650843
2-(4-chlorophenyl)-N-[2-hydroxy-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 10650843) has the molecular formula C31H33ClN4O5 and a molecular weight of 577.08 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[2-hydroxy-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(4-chlorophenyl)-N-[2-hydroxy-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 10650843 |
| Molecular Formula | C31H33ClN4O5 |
| Molecular Weight | 577.08 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[2-hydroxy-3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CC(C)Oc1ccccc1N1CCN(CC(O)CNC(=O)c2ccc3c(c2)C(=O)N(c2ccc(Cl)cc2)C3=O)CC1 |
| InChI | InChI=1S/C31H33ClN4O5/c1-20(2)41-28-6-4-3-5-27(28)35-15-13-34(14-16-35)19-24(37)18-33-29(38)21-7-12-25-26(17-21)31(40)36(30(25)39)23-10-8-22(32)9-11-23/h3-12,17,20,24,37H,13-16,18-19H2,1-2H3,(H,33,38) |
| InChIKey | CBIKMYNJCCYRFA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.08 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|