C33H39N5O4 — CID 10674564
2-[4-(dimethylamino)phenyl]-1,3-dioxo-N-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]isoindole-5-carboxamide (PubChem CID 10674564) has the molecular formula C33H39N5O4 and a molecular weight of 569.71 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-1,3-dioxo-N-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]isoindole-5-carboxamide.
| Compound Name | 2-[4-(dimethylamino)phenyl]-1,3-dioxo-N-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]isoindole-5-carboxamide |
|---|---|
| PubChem CID | 10674564 |
| Molecular Formula | C33H39N5O4 |
| Molecular Weight | 569.71 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-1,3-dioxo-N-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propyl]isoindole-5-carboxamide |
| SMILES | CC(C)Oc1ccccc1N1CCN(CCCNC(=O)c2ccc3c(c2)C(=O)N(c2ccc(N(C)C)cc2)C3=O)CC1 |
| InChI | InChI=1S/C33H39N5O4/c1-23(2)42-30-9-6-5-8-29(30)37-20-18-36(19-21-37)17-7-16-34-31(39)24-10-15-27-28(22-24)33(41)38(32(27)40)26-13-11-25(12-14-26)35(3)4/h5-6,8-15,22-23H,7,16-21H2,1-4H3,(H,34,39) |
| InChIKey | OTYOCRKXZWOSNV-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.71 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|