C11H18N3O3P — CID 22976984
ethyl (E)-4-(aminophosphanylideneamino)-5-(2-oxopyrrolidin-3-yl)pent-2-enoate (PubChem CID 22976984) has the molecular formula C11H18N3O3P and a molecular weight of 271.26 g/mol. Its IUPAC name is ethyl (E)-4-(aminophosphanylideneamino)-5-(2-oxopyrrolidin-3-yl)pent-2-enoate.
| Compound Name | ethyl (E)-4-(aminophosphanylideneamino)-5-(2-oxopyrrolidin-3-yl)pent-2-enoate |
|---|---|
| PubChem CID | 22976984 |
| Molecular Formula | C11H18N3O3P |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | ethyl (E)-4-(aminophosphanylideneamino)-5-(2-oxopyrrolidin-3-yl)pent-2-enoate |
| SMILES | CCOC(=O)/C=C/C(CC1CCNC1=O)/N=P/N |
| InChI | InChI=1S/C11H18N3O3P/c1-2-17-10(15)4-3-9(14-18-12)7-8-5-6-13-11(8)16/h3-4,8-9H,2,5-7H2,1H3,(H2,12,14)(H,13,16)/b4-3+ |
| InChIKey | WTPWPNUZNXHNHW-ONEGZZNKSA-N |
| XLogP | 1.00 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|