C17H24O3S — CID 22982229
2-bicyclo[2.2.1]heptanyl 4-butan-2-ylbenzenesulfonate (PubChem CID 22982229) has the molecular formula C17H24O3S and a molecular weight of 308.44 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]heptanyl 4-butan-2-ylbenzenesulfonate.
| Compound Name | 2-bicyclo[2.2.1]heptanyl 4-butan-2-ylbenzenesulfonate |
|---|---|
| PubChem CID | 22982229 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 2-bicyclo[2.2.1]heptanyl 4-butan-2-ylbenzenesulfonate |
| SMILES | CCC(C)c1ccc(S(=O)(=O)OC2CC3CCC2C3)cc1 |
| InChI | InChI=1S/C17H24O3S/c1-3-12(2)14-6-8-16(9-7-14)21(18,19)20-17-11-13-4-5-15(17)10-13/h6-9,12-13,15,17H,3-5,10-11H2,1-2H3 |
| InChIKey | MGDKTARHBAJOPH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|