C27H32N4O5 — CID 22984264
(2S)-2-[(2-cyclopentylacetyl)amino]-N-(1,5-dimethyl-2,4-dioxo-1,5-benzodiazepin-3-yl)-3-(4-hydroxyphenyl)propanamide (PubChem CID 22984264) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is (2S)-2-[(2-cyclopentylacetyl)amino]-N-(1,5-dimethyl-2,4-dioxo-1,5-benzodiazepin-3-yl)-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2S)-2-[(2-cyclopentylacetyl)amino]-N-(1,5-dimethyl-2,4-dioxo-1,5-benzodiazepin-3-yl)-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 22984264 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | (2S)-2-[(2-cyclopentylacetyl)amino]-N-(1,5-dimethyl-2,4-dioxo-1,5-benzodiazepin-3-yl)-3-(4-hydroxyphenyl)propanamide |
| SMILES | CN1C(=O)C(NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)CC2CCCC2)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C27H32N4O5/c1-30-21-9-5-6-10-22(21)31(2)27(36)24(26(30)35)29-25(34)20(15-18-11-13-19(32)14-12-18)28-23(33)16-17-7-3-4-8-17/h5-6,9-14,17,20,24,32H,3-4,7-8,15-16H2,1-2H3,(H,28,33)(H,29,34)/t20-/m0/s1 |
| InChIKey | NSLCTRMTAMFQGL-FQEVSTJZSA-N |
| XLogP | 2.12 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|