C26H32N4O4S — CID 10141558
2-[(2-cyclopropylacetyl)amino]-N-[2,4-dioxo-1,5-di(propan-2-yl)-1,5-benzodiazepin-3-yl]-2-thiophen-2-ylacetamide (PubChem CID 10141558) has the molecular formula C26H32N4O4S and a molecular weight of 496.63 g/mol. Its IUPAC name is 2-[(2-cyclopropylacetyl)amino]-N-[2,4-dioxo-1,5-di(propan-2-yl)-1,5-benzodiazepin-3-yl]-2-thiophen-2-ylacetamide.
| Compound Name | 2-[(2-cyclopropylacetyl)amino]-N-[2,4-dioxo-1,5-di(propan-2-yl)-1,5-benzodiazepin-3-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 10141558 |
| Molecular Formula | C26H32N4O4S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 2-[(2-cyclopropylacetyl)amino]-N-[2,4-dioxo-1,5-di(propan-2-yl)-1,5-benzodiazepin-3-yl]-2-thiophen-2-ylacetamide |
| SMILES | CC(C)N1C(=O)C(NC(=O)C(NC(=O)CC2CC2)c2cccs2)C(=O)N(C(C)C)c2ccccc21 |
| InChI | InChI=1S/C26H32N4O4S/c1-15(2)29-18-8-5-6-9-19(18)30(16(3)4)26(34)23(25(29)33)28-24(32)22(20-10-7-13-35-20)27-21(31)14-17-11-12-17/h5-10,13,15-17,22-23H,11-12,14H2,1-4H3,(H,27,31)(H,28,32) |
| InChIKey | ZNHWHOMSOXTCJU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|