C28H30N4O3S — CID 22984536
N-[(2S)-1-[[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]amino]-1-oxopropan-2-yl]-5-thiophen-2-ylpentanamide (PubChem CID 22984536) has the molecular formula C28H30N4O3S and a molecular weight of 502.64 g/mol. Its IUPAC name is N-[(2S)-1-[[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]amino]-1-oxopropan-2-yl]-5-thiophen-2-ylpentanamide.
| Compound Name | N-[(2S)-1-[[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]amino]-1-oxopropan-2-yl]-5-thiophen-2-ylpentanamide |
|---|---|
| PubChem CID | 22984536 |
| Molecular Formula | C28H30N4O3S |
| Molecular Weight | 502.64 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | N-[(2S)-1-[[(3S)-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepin-3-yl]amino]-1-oxopropan-2-yl]-5-thiophen-2-ylpentanamide |
| SMILES | C[C@H](NC(=O)CCCCc1cccs1)C(=O)N[C@H]1N=C(c2ccccc2)c2ccccc2N(C)C1=O |
| InChI | InChI=1S/C28H30N4O3S/c1-19(29-24(33)17-9-6-13-21-14-10-18-36-21)27(34)31-26-28(35)32(2)23-16-8-7-15-22(23)25(30-26)20-11-4-3-5-12-20/h3-5,7-8,10-12,14-16,18-19,26H,6,9,13,17H2,1-2H3,(H,29,33)(H,31,34)/t19-,26+/m0/s1 |
| InChIKey | MGFWBWMEMPVXRG-AFMDSPMNSA-N |
| XLogP | 3.92 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|