methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate

C12H22N2O3 — CID 22985327

IUPACmethyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate
SMILESCNC1CCC(C)(C)CN(CC(=O)OC)C1=O
InChIInChI=1S/C12H22N2O3/c1-12(2)6-5-9(13-3)11(16)14(8-12)7-10(15)17-4/h9,13H,5-8H2,1-4H3
InChIKeyQHPADEQOACECQV-UHFFFAOYSA-N
MW242.32 g/mol
LogP0.40
Rot. Bonds3

About methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate

methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate (PubChem CID 22985327) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate
PubChem CID22985327
Molecular FormulaC12H22N2O3
Molecular Weight242.32 g/mol
Exact Mass242.16
IUPAC Namemethyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate
SMILESCNC1CCC(C)(C)CN(CC(=O)OC)C1=O
InChIInChI=1S/C12H22N2O3/c1-12(2)6-5-9(13-3)11(16)14(8-12)7-10(15)17-4/h9,13H,5-8H2,1-4H3
InChIKeyQHPADEQOACECQV-UHFFFAOYSA-N
XLogP0.40
TPSA58.64 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500242.32
LogP ≤ 50.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate?
The IUPAC name of methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate (CID 22985327) is methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate.
What is the SMILES notation for methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate?
The canonical SMILES for methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate is CNC1CCC(C)(C)CN(CC(=O)OC)C1=O.
What is the InChIKey of methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate?
The InChIKey is QHPADEQOACECQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3/c1-12(2)6-5-9(13-3)11(16)14(8-12)7-10(15)17-4/h9,13H,5-8H2,1-4H3.
What are the key properties of methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate?
methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate has a molecular weight of 242.32 g/mol, XLogP of 0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate is sourced from PubChem (CID 22985327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).