About methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate
methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate (PubChem CID 22985327) has the molecular formula C12H22N2O3
and a molecular weight of 242.32 g/mol. Its IUPAC name is methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate.
Analyze methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate?
The IUPAC name of methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate (CID 22985327) is methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate.
What is the SMILES notation for methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate?
The canonical SMILES for methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate is CNC1CCC(C)(C)CN(CC(=O)OC)C1=O.
What is the InChIKey of methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate?
The InChIKey is QHPADEQOACECQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O3/c1-12(2)6-5-9(13-3)11(16)14(8-12)7-10(15)17-4/h9,13H,5-8H2,1-4H3.
What are the key properties of methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate?
methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate has a molecular weight of 242.32 g/mol, XLogP of 0.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[6,6-dimethyl-3-(methylamino)-2-oxoazepan-1-yl]acetate is sourced from PubChem (CID 22985327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).