C14H21FN2O4 — CID 138028588
2-[3-[[1-(fluoromethyl)cyclobutanecarbonyl]amino]-2-oxoazepan-1-yl]acetic acid (PubChem CID 138028588) has the molecular formula C14H21FN2O4 and a molecular weight of 300.33 g/mol. Its IUPAC name is 2-[3-[[1-(fluoromethyl)cyclobutanecarbonyl]amino]-2-oxoazepan-1-yl]acetic acid.
| Compound Name | 2-[3-[[1-(fluoromethyl)cyclobutanecarbonyl]amino]-2-oxoazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 138028588 |
| Molecular Formula | C14H21FN2O4 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2-[3-[[1-(fluoromethyl)cyclobutanecarbonyl]amino]-2-oxoazepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCCC(NC(=O)C2(CF)CCC2)C1=O |
| InChI | InChI=1S/C14H21FN2O4/c15-9-14(5-3-6-14)13(21)16-10-4-1-2-7-17(12(10)20)8-11(18)19/h10H,1-9H2,(H,16,21)(H,18,19) |
| InChIKey | WTZRJINHZZKHEU-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |