C16H26N2O5 — CID 138028605
2-[3-[3-(oxan-4-yl)propanoylamino]-2-oxoazepan-1-yl]acetic acid (PubChem CID 138028605) has the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. Its IUPAC name is 2-[3-[3-(oxan-4-yl)propanoylamino]-2-oxoazepan-1-yl]acetic acid.
| Compound Name | 2-[3-[3-(oxan-4-yl)propanoylamino]-2-oxoazepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 138028605 |
| Molecular Formula | C16H26N2O5 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 2-[3-[3-(oxan-4-yl)propanoylamino]-2-oxoazepan-1-yl]acetic acid |
| SMILES | O=C(O)CN1CCCCC(NC(=O)CCC2CCOCC2)C1=O |
| InChI | InChI=1S/C16H26N2O5/c19-14(5-4-12-6-9-23-10-7-12)17-13-3-1-2-8-18(16(13)22)11-15(20)21/h12-13H,1-11H2,(H,17,19)(H,20,21) |
| InChIKey | CNBBNIBFNUBBHD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |