C13H20N2O4 — CID 149368310
2-[(3S)-2-oxo-3-(pent-4-enoylamino)azepan-1-yl]acetic acid (PubChem CID 149368310) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-[(3S)-2-oxo-3-(pent-4-enoylamino)azepan-1-yl]acetic acid.
| Compound Name | 2-[(3S)-2-oxo-3-(pent-4-enoylamino)azepan-1-yl]acetic acid |
|---|---|
| PubChem CID | 149368310 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-[(3S)-2-oxo-3-(pent-4-enoylamino)azepan-1-yl]acetic acid |
| SMILES | C=CCCC(=O)N[C@H]1CCCCN(CC(=O)O)C1=O |
| InChI | InChI=1S/C13H20N2O4/c1-2-3-7-11(16)14-10-6-4-5-8-15(13(10)19)9-12(17)18/h2,10H,1,3-9H2,(H,14,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | YJHMTWZZSOECRU-JTQLQIEISA-N |
| XLogP | 0.53 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|