C21H24N2O7S — CID 22986145
1-O-methyl 3-O-prop-2-enyl 5-[(1-acetyl-4-acetylsulfanylpyrrolidine-2-carbonyl)amino]benzene-1,3-dicarboxylate (PubChem CID 22986145) has the molecular formula C21H24N2O7S and a molecular weight of 448.50 g/mol. Its IUPAC name is 1-O-methyl 3-O-prop-2-enyl 5-[(1-acetyl-4-acetylsulfanylpyrrolidine-2-carbonyl)amino]benzene-1,3-dicarboxylate.
| Compound Name | 1-O-methyl 3-O-prop-2-enyl 5-[(1-acetyl-4-acetylsulfanylpyrrolidine-2-carbonyl)amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 22986145 |
| Molecular Formula | C21H24N2O7S |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 1-O-methyl 3-O-prop-2-enyl 5-[(1-acetyl-4-acetylsulfanylpyrrolidine-2-carbonyl)amino]benzene-1,3-dicarboxylate |
| SMILES | C=CCOC(=O)c1cc(NC(=O)C2CC(SC(C)=O)CN2C(C)=O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H24N2O7S/c1-5-6-30-21(28)15-7-14(20(27)29-4)8-16(9-15)22-19(26)18-10-17(31-13(3)25)11-23(18)12(2)24/h5,7-9,17-18H,1,6,10-11H2,2-4H3,(H,22,26) |
| InChIKey | QCESSKIFOOFHLE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|