C18H18N4O2 — CID 22986206
1-[(4-aminophenyl)methyl]-3-[3-methyl-4-(1,3-oxazol-5-yl)phenyl]urea (PubChem CID 22986206) has the molecular formula C18H18N4O2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 1-[(4-aminophenyl)methyl]-3-[3-methyl-4-(1,3-oxazol-5-yl)phenyl]urea.
| Compound Name | 1-[(4-aminophenyl)methyl]-3-[3-methyl-4-(1,3-oxazol-5-yl)phenyl]urea |
|---|---|
| PubChem CID | 22986206 |
| Molecular Formula | C18H18N4O2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 1-[(4-aminophenyl)methyl]-3-[3-methyl-4-(1,3-oxazol-5-yl)phenyl]urea |
| SMILES | Cc1cc(NC(=O)NCc2ccc(N)cc2)ccc1-c1cnco1 |
| InChI | InChI=1S/C18H18N4O2/c1-12-8-15(6-7-16(12)17-10-20-11-24-17)22-18(23)21-9-13-2-4-14(19)5-3-13/h2-8,10-11H,9,19H2,1H3,(H2,21,22,23) |
| InChIKey | MADRJRXDHFXGEJ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|