C14H26N4O6 — CID 22986539
4-[2-[2-aminoethyl-[2-(3-carboxypropanoylamino)ethyl]amino]ethylamino]-4-oxobutanoic acid (PubChem CID 22986539) has the molecular formula C14H26N4O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is 4-[2-[2-aminoethyl-[2-(3-carboxypropanoylamino)ethyl]amino]ethylamino]-4-oxobutanoic acid.
| Compound Name | 4-[2-[2-aminoethyl-[2-(3-carboxypropanoylamino)ethyl]amino]ethylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22986539 |
| Molecular Formula | C14H26N4O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-[2-[2-aminoethyl-[2-(3-carboxypropanoylamino)ethyl]amino]ethylamino]-4-oxobutanoic acid |
| SMILES | NCCN(CCNC(=O)CCC(=O)O)CCNC(=O)CCC(=O)O |
| InChI | InChI=1S/C14H26N4O6/c15-5-8-18(9-6-16-11(19)1-3-13(21)22)10-7-17-12(20)2-4-14(23)24/h1-10,15H2,(H,16,19)(H,17,20)(H,21,22)(H,23,24) |
| InChIKey | LGFTWKZCOXPBEB-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |