C18H21F3N2O3 — CID 22986855
(1S)-2-[4-(2-aminoethyl)anilino]-1-phenylethanol;2,2,2-trifluoroacetic acid (PubChem CID 22986855) has the molecular formula C18H21F3N2O3 and a molecular weight of 370.37 g/mol. Its IUPAC name is (1S)-2-[4-(2-aminoethyl)anilino]-1-phenylethanol;2,2,2-trifluoroacetic acid.
| Compound Name | (1S)-2-[4-(2-aminoethyl)anilino]-1-phenylethanol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 22986855 |
| Molecular Formula | C18H21F3N2O3 |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (1S)-2-[4-(2-aminoethyl)anilino]-1-phenylethanol;2,2,2-trifluoroacetic acid |
| SMILES | NCCc1ccc(NC[C@@H](O)c2ccccc2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H20N2O.C2HF3O2/c17-11-10-13-6-8-15(9-7-13)18-12-16(19)14-4-2-1-3-5-14;3-2(4,5)1(6)7/h1-9,16,18-19H,10-12,17H2;(H,6,7)/t16-;/m1./s1 |
| InChIKey | YQGNJCIMLLHUBE-PKLMIRHRSA-N |
| XLogP | 2.97 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |