C16H22N2 — CID 22989568
1-[2-(4-methylpiperidin-1-yl)ethyl]indole (PubChem CID 22989568) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 1-[2-(4-methylpiperidin-1-yl)ethyl]indole.
| Compound Name | 1-[2-(4-methylpiperidin-1-yl)ethyl]indole |
|---|---|
| PubChem CID | 22989568 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1-[2-(4-methylpiperidin-1-yl)ethyl]indole |
| SMILES | CC1CCN(CCn2ccc3ccccc32)CC1 |
| InChI | InChI=1S/C16H22N2/c1-14-6-9-17(10-7-14)12-13-18-11-8-15-4-2-3-5-16(15)18/h2-5,8,11,14H,6-7,9-10,12-13H2,1H3 |
| InChIKey | MYMRNTBKXKFLCD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |