C19H28N2O — CID 91188508
1-[3-[1-(2-methoxyethyl)piperidin-4-yl]propyl]indole (PubChem CID 91188508) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-[3-[1-(2-methoxyethyl)piperidin-4-yl]propyl]indole.
| Compound Name | 1-[3-[1-(2-methoxyethyl)piperidin-4-yl]propyl]indole |
|---|---|
| PubChem CID | 91188508 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 1-[3-[1-(2-methoxyethyl)piperidin-4-yl]propyl]indole |
| SMILES | COCCN1CCC(CCCn2ccc3ccccc32)CC1 |
| InChI | InChI=1S/C19H28N2O/c1-22-16-15-20-12-8-17(9-13-20)5-4-11-21-14-10-18-6-2-3-7-19(18)21/h2-3,6-7,10,14,17H,4-5,8-9,11-13,15-16H2,1H3 |
| InChIKey | ZEARSMYAWACMDQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |