C30H28BrO4P — CID 22989846
(5,6-diethoxy-3-oxo-1H-2-benzofuran-1-yl)-triphenylphosphanium bromide (PubChem CID 22989846) has the molecular formula C30H28BrO4P and a molecular weight of 563.43 g/mol. Its IUPAC name is (5,6-diethoxy-3-oxo-1H-2-benzofuran-1-yl)-triphenylphosphanium bromide.
| Compound Name | (5,6-diethoxy-3-oxo-1H-2-benzofuran-1-yl)-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 22989846 |
| Molecular Formula | C30H28BrO4P |
| Molecular Weight | 563.43 g/mol |
| Exact Mass | 562.09 |
| IUPAC Name | (5,6-diethoxy-3-oxo-1H-2-benzofuran-1-yl)-triphenylphosphanium bromide |
| SMILES | CCOc1cc2c(cc1OCC)C([P+](c1ccccc1)(c1ccccc1)c1ccccc1)OC2=O.[Br-] |
| InChI | InChI=1S/C30H28O4P.BrH/c1-3-32-27-20-25-26(21-28(27)33-4-2)30(34-29(25)31)35(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24;/h5-21,30H,3-4H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | LACMZHMOICUKGN-UHFFFAOYSA-M |
| XLogP | 2.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|