About tris(2-aminoethanol);2-chloroacetic acid
tris(2-aminoethanol);2-chloroacetic acid (PubChem CID 22995154) has the molecular formula C8H24ClN3O5
and a molecular weight of 277.75 g/mol. Its IUPAC name is tris(2-aminoethanol);2-chloroacetic acid.
Molecular Properties
| Compound Name | tris(2-aminoethanol);2-chloroacetic acid |
| PubChem CID | 22995154 |
| Molecular Formula | C8H24ClN3O5 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | tris(2-aminoethanol);2-chloroacetic acid |
| SMILES | NCCO.NCCO.NCCO.O=C(O)CCl |
| InChI | InChI=1S/C2H3ClO2.3C2H7NO/c3-1-2(4)5;3*3-1-2-4/h1H2,(H,4,5);3*4H,1-3H2 |
| InChIKey | SRNDJDFCNCMZKQ-UHFFFAOYSA-N |
| XLogP | -2.88 |
| TPSA | 176.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | -2.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze tris(2-aminoethanol);2-chloroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(2-aminoethanol);2-chloroacetic acid?
The IUPAC name of tris(2-aminoethanol);2-chloroacetic acid (CID 22995154) is tris(2-aminoethanol);2-chloroacetic acid.
What is the SMILES notation for tris(2-aminoethanol);2-chloroacetic acid?
The canonical SMILES for tris(2-aminoethanol);2-chloroacetic acid is NCCO.NCCO.NCCO.O=C(O)CCl.
What is the InChIKey of tris(2-aminoethanol);2-chloroacetic acid?
The InChIKey is SRNDJDFCNCMZKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3ClO2.3C2H7NO/c3-1-2(4)5;3*3-1-2-4/h1H2,(H,4,5);3*4H,1-3H2.
What are the key properties of tris(2-aminoethanol);2-chloroacetic acid?
tris(2-aminoethanol);2-chloroacetic acid has a molecular weight of 277.75 g/mol, XLogP of -2.88, 4 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tris(2-aminoethanol);2-chloroacetic acid is sourced from PubChem (CID 22995154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).