About 2-aminoacetic acid;2-aminoethanol;carbamic acid
2-aminoacetic acid;2-aminoethanol;carbamic acid (PubChem CID 87253703) has the molecular formula C5H15N3O5
and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-aminoacetic acid;2-aminoethanol;carbamic acid.
Molecular Properties
| Compound Name | 2-aminoacetic acid;2-aminoethanol;carbamic acid |
| PubChem CID | 87253703 |
| Molecular Formula | C5H15N3O5 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2-aminoacetic acid;2-aminoethanol;carbamic acid |
| SMILES | NC(=O)O.NCC(=O)O.NCCO |
| InChI | InChI=1S/C2H5NO2.C2H7NO.CH3NO2/c3-1-2(4)5;3-1-2-4;2-1(3)4/h1,3H2,(H,4,5);4H,1-3H2;2H2,(H,3,4) |
| InChIKey | XLARZIHOGIVSHT-UHFFFAOYSA-N |
| XLogP | -2.41 |
| TPSA | 172.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-aminoacetic acid;2-aminoethanol;carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;2-aminoethanol;carbamic acid?
The IUPAC name of 2-aminoacetic acid;2-aminoethanol;carbamic acid (CID 87253703) is 2-aminoacetic acid;2-aminoethanol;carbamic acid.
What is the SMILES notation for 2-aminoacetic acid;2-aminoethanol;carbamic acid?
The canonical SMILES for 2-aminoacetic acid;2-aminoethanol;carbamic acid is NC(=O)O.NCC(=O)O.NCCO.
What is the InChIKey of 2-aminoacetic acid;2-aminoethanol;carbamic acid?
The InChIKey is XLARZIHOGIVSHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.C2H7NO.CH3NO2/c3-1-2(4)5;3-1-2-4;2-1(3)4/h1,3H2,(H,4,5);4H,1-3H2;2H2,(H,3,4).
What are the key properties of 2-aminoacetic acid;2-aminoethanol;carbamic acid?
2-aminoacetic acid;2-aminoethanol;carbamic acid has a molecular weight of 197.19 g/mol, XLogP of -2.41, 2 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;2-aminoethanol;carbamic acid is sourced from PubChem (CID 87253703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).