2-aminoacetic acid;2-aminoethanol;carbamic acid

C5H15N3O5 — CID 87253703

IUPAC2-aminoacetic acid;2-aminoethanol;carbamic acid
SMILESNC(=O)O.NCC(=O)O.NCCO
InChIInChI=1S/C2H5NO2.C2H7NO.CH3NO2/c3-1-2(4)5;3-1-2-4;2-1(3)4/h1,3H2,(H,4,5);4H,1-3H2;2H2,(H,3,4)
InChIKeyXLARZIHOGIVSHT-UHFFFAOYSA-N
MW197.19 g/mol
LogP-2.41
Rot. Bonds2

About 2-aminoacetic acid;2-aminoethanol;carbamic acid

2-aminoacetic acid;2-aminoethanol;carbamic acid (PubChem CID 87253703) has the molecular formula C5H15N3O5 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-aminoacetic acid;2-aminoethanol;carbamic acid.

Molecular Properties

Compound Name2-aminoacetic acid;2-aminoethanol;carbamic acid
PubChem CID87253703
Molecular FormulaC5H15N3O5
Molecular Weight197.19 g/mol
Exact Mass197.10
IUPAC Name2-aminoacetic acid;2-aminoethanol;carbamic acid
SMILESNC(=O)O.NCC(=O)O.NCCO
InChIInChI=1S/C2H5NO2.C2H7NO.CH3NO2/c3-1-2(4)5;3-1-2-4;2-1(3)4/h1,3H2,(H,4,5);4H,1-3H2;2H2,(H,3,4)
InChIKeyXLARZIHOGIVSHT-UHFFFAOYSA-N
XLogP-2.41
TPSA172.89 Ų
H-Bond Donors6
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500197.19
LogP ≤ 5-2.41
H-Bond Donors ≤ 56
H-Bond Acceptors ≤ 105

Analyze 2-aminoacetic acid;2-aminoethanol;carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminoacetic acid;2-aminoethanol;carbamic acid?
The IUPAC name of 2-aminoacetic acid;2-aminoethanol;carbamic acid (CID 87253703) is 2-aminoacetic acid;2-aminoethanol;carbamic acid.
What is the SMILES notation for 2-aminoacetic acid;2-aminoethanol;carbamic acid?
The canonical SMILES for 2-aminoacetic acid;2-aminoethanol;carbamic acid is NC(=O)O.NCC(=O)O.NCCO.
What is the InChIKey of 2-aminoacetic acid;2-aminoethanol;carbamic acid?
The InChIKey is XLARZIHOGIVSHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5NO2.C2H7NO.CH3NO2/c3-1-2(4)5;3-1-2-4;2-1(3)4/h1,3H2,(H,4,5);4H,1-3H2;2H2,(H,3,4).
What are the key properties of 2-aminoacetic acid;2-aminoethanol;carbamic acid?
2-aminoacetic acid;2-aminoethanol;carbamic acid has a molecular weight of 197.19 g/mol, XLogP of -2.41, 2 rotatable bonds, 6 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;2-aminoethanol;carbamic acid is sourced from PubChem (CID 87253703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).