C23H38N2O5 — CID 22996340
tert-butyl N-[3-hydroxy-4-[4-(2-methyl-1,3-dioxolan-2-yl)butylamino]-1-phenylbutan-2-yl]carbamate (PubChem CID 22996340) has the molecular formula C23H38N2O5 and a molecular weight of 422.57 g/mol. Its IUPAC name is tert-butyl N-[3-hydroxy-4-[4-(2-methyl-1,3-dioxolan-2-yl)butylamino]-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-hydroxy-4-[4-(2-methyl-1,3-dioxolan-2-yl)butylamino]-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 22996340 |
| Molecular Formula | C23H38N2O5 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | tert-butyl N-[3-hydroxy-4-[4-(2-methyl-1,3-dioxolan-2-yl)butylamino]-1-phenylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(Cc1ccccc1)C(O)CNCCCCC1(C)OCCO1 |
| InChI | InChI=1S/C23H38N2O5/c1-22(2,3)30-21(27)25-19(16-18-10-6-5-7-11-18)20(26)17-24-13-9-8-12-23(4)28-14-15-29-23/h5-7,10-11,19-20,24,26H,8-9,12-17H2,1-4H3,(H,25,27) |
| InChIKey | IYBOTQIXHNBDHV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|