C25H42N2O3 — CID 142012151
tert-butyl N-[(2S)-4-(3,7-dimethyloct-7-enylamino)-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 142012151) has the molecular formula C25H42N2O3 and a molecular weight of 418.62 g/mol. Its IUPAC name is tert-butyl N-[(2S)-4-(3,7-dimethyloct-7-enylamino)-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-4-(3,7-dimethyloct-7-enylamino)-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142012151 |
| Molecular Formula | C25H42N2O3 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.32 |
| IUPAC Name | tert-butyl N-[(2S)-4-(3,7-dimethyloct-7-enylamino)-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | C=C(C)CCCC(C)CCNCC(O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H42N2O3/c1-19(2)11-10-12-20(3)15-16-26-18-23(28)22(17-21-13-8-7-9-14-21)27-24(29)30-25(4,5)6/h7-9,13-14,20,22-23,26,28H,1,10-12,15-18H2,2-6H3,(H,27,29)/t20?,22-,23?/m0/s1 |
| InChIKey | XWDPMHQQESXUPD-APKLWFBNSA-N |
| XLogP | 4.85 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|