C22H15ClF3N3O3S — CID 22998138
4-[1-(4-chlorophenyl)-4-[4-(trifluoromethoxy)phenyl]imidazol-2-yl]benzenesulfonamide (PubChem CID 22998138) has the molecular formula C22H15ClF3N3O3S and a molecular weight of 493.89 g/mol. Its IUPAC name is 4-[1-(4-chlorophenyl)-4-[4-(trifluoromethoxy)phenyl]imidazol-2-yl]benzenesulfonamide.
| Compound Name | 4-[1-(4-chlorophenyl)-4-[4-(trifluoromethoxy)phenyl]imidazol-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 22998138 |
| Molecular Formula | C22H15ClF3N3O3S |
| Molecular Weight | 493.89 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | 4-[1-(4-chlorophenyl)-4-[4-(trifluoromethoxy)phenyl]imidazol-2-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2nc(-c3ccc(OC(F)(F)F)cc3)cn2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H15ClF3N3O3S/c23-16-5-7-17(8-6-16)29-13-20(14-1-9-18(10-2-14)32-22(24,25)26)28-21(29)15-3-11-19(12-4-15)33(27,30)31/h1-13H,(H2,27,30,31) |
| InChIKey | UYNIOKJSMJFBLZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.89 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |