C17H28NO+ — CID 2300224
4-(3-methyl-4-propan-2-ylphenoxy)butyl-prop-2-enylazanium (PubChem CID 2300224) has the molecular formula C17H28NO+ and a molecular weight of 262.42 g/mol. Its IUPAC name is 4-(3-methyl-4-propan-2-ylphenoxy)butyl-prop-2-enylazanium.
| Compound Name | 4-(3-methyl-4-propan-2-ylphenoxy)butyl-prop-2-enylazanium |
|---|---|
| PubChem CID | 2300224 |
| Molecular Formula | C17H28NO+ |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | 4-(3-methyl-4-propan-2-ylphenoxy)butyl-prop-2-enylazanium |
| SMILES | C=CC[NH2+]CCCCOc1ccc(C(C)C)c(C)c1 |
| InChI | InChI=1S/C17H27NO/c1-5-10-18-11-6-7-12-19-16-8-9-17(14(2)3)15(4)13-16/h5,8-9,13-14,18H,1,6-7,10-12H2,2-4H3/p+1 |
| InChIKey | MOPKWXQXGJVMLX-UHFFFAOYSA-O |
| XLogP | 3.03 |
| TPSA | 25.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|