C21H26N2O6 — CID 23004109
2-hexyl-5-methoxycarbonyl-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid (PubChem CID 23004109) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-hexyl-5-methoxycarbonyl-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid.
| Compound Name | 2-hexyl-5-methoxycarbonyl-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 23004109 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-hexyl-5-methoxycarbonyl-6-methyl-1-(4-nitrophenyl)-4H-pyridine-3-carboxylic acid |
| SMILES | CCCCCCC1=C(C(=O)O)CC(C(=O)OC)=C(C)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H26N2O6/c1-4-5-6-7-8-19-18(20(24)25)13-17(21(26)29-3)14(2)22(19)15-9-11-16(12-10-15)23(27)28/h9-12H,4-8,13H2,1-3H3,(H,24,25) |
| InChIKey | WZRHAOFOFNIDHI-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|