C14H12N4O5S2 — CID 23004533
7-methyl-N-(2-methyl-3-nitrophenyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-sulfonamide (PubChem CID 23004533) has the molecular formula C14H12N4O5S2 and a molecular weight of 380.41 g/mol. Its IUPAC name is 7-methyl-N-(2-methyl-3-nitrophenyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-sulfonamide.
| Compound Name | 7-methyl-N-(2-methyl-3-nitrophenyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-sulfonamide |
|---|---|
| PubChem CID | 23004533 |
| Molecular Formula | C14H12N4O5S2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 7-methyl-N-(2-methyl-3-nitrophenyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-sulfonamide |
| SMILES | Cc1nc2sccn2c(=O)c1S(=O)(=O)Nc1cccc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C14H12N4O5S2/c1-8-10(4-3-5-11(8)18(20)21)16-25(22,23)12-9(2)15-14-17(13(12)19)6-7-24-14/h3-7,16H,1-2H3 |
| InChIKey | DMCTUPFRYLWRLR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|