C17H17ClN4O4S2 — CID 15990182
N-(3-chloro-4-morpholin-4-ylphenyl)-7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-sulfonamide (PubChem CID 15990182) has the molecular formula C17H17ClN4O4S2 and a molecular weight of 440.93 g/mol. Its IUPAC name is N-(3-chloro-4-morpholin-4-ylphenyl)-7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-sulfonamide.
| Compound Name | N-(3-chloro-4-morpholin-4-ylphenyl)-7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-sulfonamide |
|---|---|
| PubChem CID | 15990182 |
| Molecular Formula | C17H17ClN4O4S2 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.04 |
| IUPAC Name | N-(3-chloro-4-morpholin-4-ylphenyl)-7-methyl-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-sulfonamide |
| SMILES | Cc1nc2sccn2c(=O)c1S(=O)(=O)Nc1ccc(N2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C17H17ClN4O4S2/c1-11-15(16(23)22-6-9-27-17(22)19-11)28(24,25)20-12-2-3-14(13(18)10-12)21-4-7-26-8-5-21/h2-3,6,9-10,20H,4-5,7-8H2,1H3 |
| InChIKey | VAMMLEVWZVXKEQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|