C19H27ClN4O2S — CID 86934858
1-tert-butyl-N-(3-chloro-4-pyrrolidin-1-ylphenyl)-3,5-dimethylpyrazole-4-sulfonamide (PubChem CID 86934858) has the molecular formula C19H27ClN4O2S and a molecular weight of 410.97 g/mol. Its IUPAC name is 1-tert-butyl-N-(3-chloro-4-pyrrolidin-1-ylphenyl)-3,5-dimethylpyrazole-4-sulfonamide.
| Compound Name | 1-tert-butyl-N-(3-chloro-4-pyrrolidin-1-ylphenyl)-3,5-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 86934858 |
| Molecular Formula | C19H27ClN4O2S |
| Molecular Weight | 410.97 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 1-tert-butyl-N-(3-chloro-4-pyrrolidin-1-ylphenyl)-3,5-dimethylpyrazole-4-sulfonamide |
| SMILES | Cc1nn(C(C)(C)C)c(C)c1S(=O)(=O)Nc1ccc(N2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C19H27ClN4O2S/c1-13-18(14(2)24(21-13)19(3,4)5)27(25,26)22-15-8-9-17(16(20)12-15)23-10-6-7-11-23/h8-9,12,22H,6-7,10-11H2,1-5H3 |
| InChIKey | CLNMCWAZHVSNLB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.97 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|