C21H31N5O3S — CID 86934846
1-[4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)sulfonylamino]phenyl]piperidine-4-carboxamide (PubChem CID 86934846) has the molecular formula C21H31N5O3S and a molecular weight of 433.58 g/mol. Its IUPAC name is 1-[4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)sulfonylamino]phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)sulfonylamino]phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 86934846 |
| Molecular Formula | C21H31N5O3S |
| Molecular Weight | 433.58 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 1-[4-[(1-tert-butyl-3,5-dimethylpyrazol-4-yl)sulfonylamino]phenyl]piperidine-4-carboxamide |
| SMILES | Cc1nn(C(C)(C)C)c(C)c1S(=O)(=O)Nc1ccc(N2CCC(C(N)=O)CC2)cc1 |
| InChI | InChI=1S/C21H31N5O3S/c1-14-19(15(2)26(23-14)21(3,4)5)30(28,29)24-17-6-8-18(9-7-17)25-12-10-16(11-13-25)20(22)27/h6-9,16,24H,10-13H2,1-5H3,(H2,22,27) |
| InChIKey | VKJVOPNDXFHLRT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|