2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid

C11H18N2O2 — CID 23005851

IUPAC2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid
SMILESCc1nn(C(C)C)c(C)c1C(C)C(=O)O
InChIInChI=1S/C11H18N2O2/c1-6(2)13-9(5)10(8(4)12-13)7(3)11(14)15/h6-7H,1-5H3,(H,14,15)
InChIKeyUYTUPZWIKDIQJH-UHFFFAOYSA-N
MW210.28 g/mol
LogP2.27
Rot. Bonds3

About 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid

2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid (PubChem CID 23005851) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid.

Molecular Properties

Compound Name2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid
PubChem CID23005851
Molecular FormulaC11H18N2O2
Molecular Weight210.28 g/mol
Exact Mass210.14
IUPAC Name2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid
SMILESCc1nn(C(C)C)c(C)c1C(C)C(=O)O
InChIInChI=1S/C11H18N2O2/c1-6(2)13-9(5)10(8(4)12-13)7(3)11(14)15/h6-7H,1-5H3,(H,14,15)
InChIKeyUYTUPZWIKDIQJH-UHFFFAOYSA-N
XLogP2.27
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.28
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid?
The IUPAC name of 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid (CID 23005851) is 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid.
What is the SMILES notation for 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid?
The canonical SMILES for 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid is Cc1nn(C(C)C)c(C)c1C(C)C(=O)O.
What is the InChIKey of 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid?
The InChIKey is UYTUPZWIKDIQJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-6(2)13-9(5)10(8(4)12-13)7(3)11(14)15/h6-7H,1-5H3,(H,14,15).
What are the key properties of 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid?
2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid has a molecular weight of 210.28 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)propanoic acid is sourced from PubChem (CID 23005851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).