About 2-(1,3,5-trimethylpyrazol-4-yl)ethanol
2-(1,3,5-trimethylpyrazol-4-yl)ethanol (PubChem CID 23005918) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-(1,3,5-trimethylpyrazol-4-yl)ethanol.
Molecular Properties
| Compound Name | 2-(1,3,5-trimethylpyrazol-4-yl)ethanol |
| PubChem CID | 23005918 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 2-(1,3,5-trimethylpyrazol-4-yl)ethanol |
| SMILES | Cc1nn(C)c(C)c1CCO |
| InChI | InChI=1S/C8H14N2O/c1-6-8(4-5-11)7(2)10(3)9-6/h11H,4-5H2,1-3H3 |
| InChIKey | QESMYIFDOLAREQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,3,5-trimethylpyrazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3,5-trimethylpyrazol-4-yl)ethanol?
The IUPAC name of 2-(1,3,5-trimethylpyrazol-4-yl)ethanol (CID 23005918) is 2-(1,3,5-trimethylpyrazol-4-yl)ethanol.
What is the SMILES notation for 2-(1,3,5-trimethylpyrazol-4-yl)ethanol?
The canonical SMILES for 2-(1,3,5-trimethylpyrazol-4-yl)ethanol is Cc1nn(C)c(C)c1CCO.
What is the InChIKey of 2-(1,3,5-trimethylpyrazol-4-yl)ethanol?
The InChIKey is QESMYIFDOLAREQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c1-6-8(4-5-11)7(2)10(3)9-6/h11H,4-5H2,1-3H3.
What are the key properties of 2-(1,3,5-trimethylpyrazol-4-yl)ethanol?
2-(1,3,5-trimethylpyrazol-4-yl)ethanol has a molecular weight of 154.21 g/mol, XLogP of 0.57, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3,5-trimethylpyrazol-4-yl)ethanol is sourced from PubChem (CID 23005918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).