C7H12N2O — CID 7172184
(1,3,5-trimethylpyrazol-4-yl)methanol (PubChem CID 7172184) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is (1,3,5-trimethylpyrazol-4-yl)methanol.
| Compound Name | (1,3,5-trimethylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 7172184 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (1,3,5-trimethylpyrazol-4-yl)methanol |
| SMILES | Cc1nn(C)c(C)c1CO |
| InChI | InChI=1S/C7H12N2O/c1-5-7(4-10)6(2)9(3)8-5/h10H,4H2,1-3H3 |
| InChIKey | CIZQKYSGJAQKTI-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |