C17H22N2O4S — CID 23010001
4-[2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]-3-ethoxybenzaldehyde (PubChem CID 23010001) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is 4-[2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]-3-ethoxybenzaldehyde.
| Compound Name | 4-[2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]-3-ethoxybenzaldehyde |
|---|---|
| PubChem CID | 23010001 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 4-[2-[(5-tert-butyl-1,3,4-oxadiazol-2-yl)sulfanyl]ethoxy]-3-ethoxybenzaldehyde |
| SMILES | CCOc1cc(C=O)ccc1OCCSc1nnc(C(C)(C)C)o1 |
| InChI | InChI=1S/C17H22N2O4S/c1-5-21-14-10-12(11-20)6-7-13(14)22-8-9-24-16-19-18-15(23-16)17(2,3)4/h6-7,10-11H,5,8-9H2,1-4H3 |
| InChIKey | CTQNIPCTWHNKLU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|