C21H23N3O3S — CID 23010199
4-[2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]-3-methoxybenzaldehyde (PubChem CID 23010199) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-[2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]-3-methoxybenzaldehyde.
| Compound Name | 4-[2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 23010199 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 4-[2-[[4-ethyl-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethoxy]-3-methoxybenzaldehyde |
| SMILES | CCn1c(SCCOc2ccc(C=O)cc2OC)nnc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C21H23N3O3S/c1-4-24-20(17-8-5-15(2)6-9-17)22-23-21(24)28-12-11-27-18-10-7-16(14-25)13-19(18)26-3/h5-10,13-14H,4,11-12H2,1-3H3 |
| InChIKey | LOZOQALNYMIINQ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|