C21H23N3O4S — CID 23010127
3-methoxy-4-[2-[[5-[(4-methoxyphenyl)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzaldehyde (PubChem CID 23010127) has the molecular formula C21H23N3O4S and a molecular weight of 413.50 g/mol. Its IUPAC name is 3-methoxy-4-[2-[[5-[(4-methoxyphenyl)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzaldehyde.
| Compound Name | 3-methoxy-4-[2-[[5-[(4-methoxyphenyl)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzaldehyde |
|---|---|
| PubChem CID | 23010127 |
| Molecular Formula | C21H23N3O4S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 3-methoxy-4-[2-[[5-[(4-methoxyphenyl)methyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]ethoxy]benzaldehyde |
| SMILES | COc1ccc(Cc2nnc(SCCOc3ccc(C=O)cc3OC)n2C)cc1 |
| InChI | InChI=1S/C21H23N3O4S/c1-24-20(13-15-4-7-17(26-2)8-5-15)22-23-21(24)29-11-10-28-18-9-6-16(14-25)12-19(18)27-3/h4-9,12,14H,10-11,13H2,1-3H3 |
| InChIKey | NNJZARCNOKAPSV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 75.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|