C29H31N5O5S — CID 4509091
2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]acetamide (PubChem CID 4509091) has the molecular formula C29H31N5O5S and a molecular weight of 561.66 g/mol. Its IUPAC name is 2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4509091 |
| Molecular Formula | C29H31N5O5S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(4-methoxy-3-phenylmethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCn1c(SCC(=O)NN=Cc2ccc(OC)c(OCc3ccccc3)c2)nnc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C29H31N5O5S/c1-5-34-28(22-12-14-23(36-2)25(16-22)38-4)32-33-29(34)40-19-27(35)31-30-17-21-11-13-24(37-3)26(15-21)39-18-20-9-7-6-8-10-20/h6-17H,5,18-19H2,1-4H3,(H,31,35) |
| InChIKey | OULYFQQZAZVPST-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|