C24H29N5O6S — CID 4509604
2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2,4,6-trimethoxyphenyl)methylideneamino]acetamide (PubChem CID 4509604) has the molecular formula C24H29N5O6S and a molecular weight of 515.59 g/mol. Its IUPAC name is 2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2,4,6-trimethoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2,4,6-trimethoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 4509604 |
| Molecular Formula | C24H29N5O6S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | 2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(2,4,6-trimethoxyphenyl)methylideneamino]acetamide |
| SMILES | CCn1c(SCC(=O)NN=Cc2c(OC)cc(OC)cc2OC)nnc1-c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H29N5O6S/c1-7-29-23(15-8-9-18(32-3)21(10-15)35-6)27-28-24(29)36-14-22(30)26-25-13-17-19(33-4)11-16(31-2)12-20(17)34-5/h8-13H,7,14H2,1-6H3,(H,26,30) |
| InChIKey | PJFMHOHWMBUZGS-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 118.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|