C26H33N5O4S — CID 6082737
2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-pentoxyphenyl)methylideneamino]acetamide (PubChem CID 6082737) has the molecular formula C26H33N5O4S and a molecular weight of 511.65 g/mol. Its IUPAC name is 2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-pentoxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-pentoxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6082737 |
| Molecular Formula | C26H33N5O4S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 2-[[5-(3,4-dimethoxyphenyl)-4-ethyl-1,2,4-triazol-3-yl]sulfanyl]-N-[(Z)-(4-pentoxyphenyl)methylideneamino]acetamide |
| SMILES | CCCCCOc1ccc(/C=N\NC(=O)CSc2nnc(-c3ccc(OC)c(OC)c3)n2CC)cc1 |
| InChI | InChI=1S/C26H33N5O4S/c1-5-7-8-15-35-21-12-9-19(10-13-21)17-27-28-24(32)18-36-26-30-29-25(31(26)6-2)20-11-14-22(33-3)23(16-20)34-4/h9-14,16-17H,5-8,15,18H2,1-4H3,(H,28,32)/b27-17- |
| InChIKey | AFHKMHKJZBNWFE-PKAZHMFMSA-N |
| XLogP | 4.79 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|