C5H2Cl3N — CID 23016
2,3,6-trichloropyridine (PubChem CID 23016) has the molecular formula C5H2Cl3N and a molecular weight of 182.44 g/mol. Its IUPAC name is 2,3,6-trichloropyridine.
| Compound Name | 2,3,6-trichloropyridine |
|---|---|
| PubChem CID | 23016 |
| Molecular Formula | C5H2Cl3N |
| Molecular Weight | 182.44 g/mol |
| Exact Mass | 180.93 |
| IUPAC Name | 2,3,6-trichloropyridine |
| SMILES | Clc1ccc(Cl)c(Cl)n1 |
| InChI | InChI=1S/C5H2Cl3N/c6-3-1-2-4(7)9-5(3)8/h1-2H |
| InChIKey | GPAKJVMKNDXBHH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|