C5Cl5N — CID 16584
2,3,4,5,6-pentachloropyridine (PubChem CID 16584) has the molecular formula C5Cl5N and a molecular weight of 251.33 g/mol. Its IUPAC name is 2,3,4,5,6-pentachloropyridine.
| Compound Name | 2,3,4,5,6-pentachloropyridine |
|---|---|
| PubChem CID | 16584 |
| Molecular Formula | C5Cl5N |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 248.85 |
| IUPAC Name | 2,3,4,5,6-pentachloropyridine |
| SMILES | Clc1nc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C5Cl5N/c6-1-2(7)4(9)11-5(10)3(1)8 |
| InChIKey | DNDPLEAVNVOOQZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|