C11H18Cl2Si — CID 23016483
dichloro-(1-cyclohex-2-en-1-ylethyl)-prop-2-enylsilane (PubChem CID 23016483) has the molecular formula C11H18Cl2Si and a molecular weight of 249.26 g/mol. Its IUPAC name is dichloro-(1-cyclohex-2-en-1-ylethyl)-prop-2-enylsilane.
| Compound Name | dichloro-(1-cyclohex-2-en-1-ylethyl)-prop-2-enylsilane |
|---|---|
| PubChem CID | 23016483 |
| Molecular Formula | C11H18Cl2Si |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | dichloro-(1-cyclohex-2-en-1-ylethyl)-prop-2-enylsilane |
| SMILES | C=CC[Si](Cl)(Cl)C(C)C1C=CCCC1 |
| InChI | InChI=1S/C11H18Cl2Si/c1-3-9-14(12,13)10(2)11-7-5-4-6-8-11/h3,5,7,10-11H,1,4,6,8-9H2,2H3 |
| InChIKey | DRPDVWXFDCNPPB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|