C13H13N5O2S3 — CID 2301870
N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]thiophene-2-sulfonamide (PubChem CID 2301870) has the molecular formula C13H13N5O2S3 and a molecular weight of 367.48 g/mol. Its IUPAC name is N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2301870 |
| Molecular Formula | C13H13N5O2S3 |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | N-[2-(1-phenyltetrazol-5-yl)sulfanylethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCSc1nnnn1-c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C13H13N5O2S3/c19-23(20,12-7-4-9-21-12)14-8-10-22-13-15-16-17-18(13)11-5-2-1-3-6-11/h1-7,9,14H,8,10H2 |
| InChIKey | BPMFLHUOPFEGTO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|