C17H23Br2N3O3 — CID 2302264
(2R)-2-bromo-N-[2-[[[(2R)-2-bromopentanoyl]amino]carbamoyl]phenyl]pentanamide (PubChem CID 2302264) has the molecular formula C17H23Br2N3O3 and a molecular weight of 477.20 g/mol. Its IUPAC name is (2R)-2-bromo-N-[2-[[[(2R)-2-bromopentanoyl]amino]carbamoyl]phenyl]pentanamide.
| Compound Name | (2R)-2-bromo-N-[2-[[[(2R)-2-bromopentanoyl]amino]carbamoyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 2302264 |
| Molecular Formula | C17H23Br2N3O3 |
| Molecular Weight | 477.20 g/mol |
| Exact Mass | 475.01 |
| IUPAC Name | (2R)-2-bromo-N-[2-[[[(2R)-2-bromopentanoyl]amino]carbamoyl]phenyl]pentanamide |
| SMILES | CCC[C@@H](Br)C(=O)NNC(=O)c1ccccc1NC(=O)[C@H](Br)CCC |
| InChI | InChI=1S/C17H23Br2N3O3/c1-3-7-12(18)16(24)20-14-10-6-5-9-11(14)15(23)21-22-17(25)13(19)8-4-2/h5-6,9-10,12-13H,3-4,7-8H2,1-2H3,(H,20,24)(H,21,23)(H,22,25)/t12-,13-/m1/s1 |
| InChIKey | AYFXFNRNBFMFDV-CHWSQXEVSA-N |
| XLogP | 3.51 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.20 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|