C13H14ClNO2S2 — CID 23032572
4-[3-(chloromethyl)benzenecarbothioyl]thiomorpholine-3-carboxylic acid (PubChem CID 23032572) has the molecular formula C13H14ClNO2S2 and a molecular weight of 315.85 g/mol. Its IUPAC name is 4-[3-(chloromethyl)benzenecarbothioyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[3-(chloromethyl)benzenecarbothioyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 23032572 |
| Molecular Formula | C13H14ClNO2S2 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 4-[3-(chloromethyl)benzenecarbothioyl]thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1C(=S)c1cccc(CCl)c1 |
| InChI | InChI=1S/C13H14ClNO2S2/c14-7-9-2-1-3-10(6-9)12(18)15-4-5-19-8-11(15)13(16)17/h1-3,6,11H,4-5,7-8H2,(H,16,17) |
| InChIKey | DBKWHRPHZHRFNJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|