C14H14O5S — CID 23035251
4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoic acid (PubChem CID 23035251) has the molecular formula C14H14O5S and a molecular weight of 294.33 g/mol. Its IUPAC name is 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoic acid.
| Compound Name | 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 23035251 |
| Molecular Formula | C14H14O5S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 4-(5,6-dimethoxy-1-benzothiophen-2-yl)-4-oxobutanoic acid |
| SMILES | COc1cc2cc(C(=O)CCC(=O)O)sc2cc1OC |
| InChI | InChI=1S/C14H14O5S/c1-18-10-5-8-6-13(9(15)3-4-14(16)17)20-12(8)7-11(10)19-2/h5-7H,3-4H2,1-2H3,(H,16,17) |
| InChIKey | APCLRHPWFCQIMG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |