C23H35N — CID 23036208
1-[2-[(4-tert-butylphenyl)methyl]prop-2-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline (PubChem CID 23036208) has the molecular formula C23H35N and a molecular weight of 325.54 g/mol. Its IUPAC name is 1-[2-[(4-tert-butylphenyl)methyl]prop-2-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline.
| Compound Name | 1-[2-[(4-tert-butylphenyl)methyl]prop-2-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
|---|---|
| PubChem CID | 23036208 |
| Molecular Formula | C23H35N |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | 1-[2-[(4-tert-butylphenyl)methyl]prop-2-enyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline |
| SMILES | C=C(Cc1ccc(C(C)(C)C)cc1)CN1CCCC2CCCCC21 |
| InChI | InChI=1S/C23H35N/c1-18(16-19-11-13-21(14-12-19)23(2,3)4)17-24-15-7-9-20-8-5-6-10-22(20)24/h11-14,20,22H,1,5-10,15-17H2,2-4H3 |
| InChIKey | FHBPLBVSCUQYGQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|