C27H23ClN2O2 — CID 23040717
1-benzyl-N-(2-chlorophenyl)-6-methyl-2-(2-methylphenyl)-4-oxopyridine-3-carboxamide (PubChem CID 23040717) has the molecular formula C27H23ClN2O2 and a molecular weight of 442.95 g/mol. Its IUPAC name is 1-benzyl-N-(2-chlorophenyl)-6-methyl-2-(2-methylphenyl)-4-oxopyridine-3-carboxamide.
| Compound Name | 1-benzyl-N-(2-chlorophenyl)-6-methyl-2-(2-methylphenyl)-4-oxopyridine-3-carboxamide |
|---|---|
| PubChem CID | 23040717 |
| Molecular Formula | C27H23ClN2O2 |
| Molecular Weight | 442.95 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-benzyl-N-(2-chlorophenyl)-6-methyl-2-(2-methylphenyl)-4-oxopyridine-3-carboxamide |
| SMILES | Cc1ccccc1-c1c(C(=O)Nc2ccccc2Cl)c(=O)cc(C)n1Cc1ccccc1 |
| InChI | InChI=1S/C27H23ClN2O2/c1-18-10-6-7-13-21(18)26-25(27(32)29-23-15-9-8-14-22(23)28)24(31)16-19(2)30(26)17-20-11-4-3-5-12-20/h3-16H,17H2,1-2H3,(H,29,32) |
| InChIKey | UNDFQNLXRWGZJV-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.95 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |