C15H18ClN4S+ — CID 2304116
1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yl)hydrazine (PubChem CID 2304116) has the molecular formula C15H18ClN4S+ and a molecular weight of 321.86 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yl)hydrazine.
| Compound Name | 1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yl)hydrazine |
|---|---|
| PubChem CID | 2304116 |
| Molecular Formula | C15H18ClN4S+ |
| Molecular Weight | 321.86 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-[4-(4-chlorophenyl)-1,3-thiazol-2-yl]-2-(3,4,5,6-tetrahydro-2H-azepin-1-ium-7-yl)hydrazine |
| SMILES | Clc1ccc(-c2csc(NNC3=[NH+]CCCCC3)n2)cc1 |
| InChI | InChI=1S/C15H17ClN4S/c16-12-7-5-11(6-8-12)13-10-21-15(18-13)20-19-14-4-2-1-3-9-17-14/h5-8,10H,1-4,9H2,(H,17,19)(H,18,20)/p+1 |
| InChIKey | NWCXGLKPKIACKU-UHFFFAOYSA-O |
| XLogP | 2.43 |
| TPSA | 50.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.86 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|