C23H31ClN2O — CID 23043744
(E)-3-[1-(2-chlorophenyl)ethenyl]-5,5-dimethyl-N-(2-piperidin-1-ylethoxy)cyclohex-2-en-1-imine (PubChem CID 23043744) has the molecular formula C23H31ClN2O and a molecular weight of 386.97 g/mol. Its IUPAC name is (E)-3-[1-(2-chlorophenyl)ethenyl]-5,5-dimethyl-N-(2-piperidin-1-ylethoxy)cyclohex-2-en-1-imine.
| Compound Name | (E)-3-[1-(2-chlorophenyl)ethenyl]-5,5-dimethyl-N-(2-piperidin-1-ylethoxy)cyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 23043744 |
| Molecular Formula | C23H31ClN2O |
| Molecular Weight | 386.97 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (E)-3-[1-(2-chlorophenyl)ethenyl]-5,5-dimethyl-N-(2-piperidin-1-ylethoxy)cyclohex-2-en-1-imine |
| SMILES | C=C(C1=C/C(=N/OCCN2CCCCC2)CC(C)(C)C1)c1ccccc1Cl |
| InChI | InChI=1S/C23H31ClN2O/c1-18(21-9-5-6-10-22(21)24)19-15-20(17-23(2,3)16-19)25-27-14-13-26-11-7-4-8-12-26/h5-6,9-10,15H,1,4,7-8,11-14,16-17H2,2-3H3/b25-20- |
| InChIKey | ASTOMLVONVYGHY-QQTULTPQSA-N |
| XLogP | 5.96 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.97 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|