C13H17NO4 — CID 23045730
diethyl 2,3-dihydro-1H-pyrrolizine-1,7-dicarboxylate (PubChem CID 23045730) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is diethyl 2,3-dihydro-1H-pyrrolizine-1,7-dicarboxylate.
| Compound Name | diethyl 2,3-dihydro-1H-pyrrolizine-1,7-dicarboxylate |
|---|---|
| PubChem CID | 23045730 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | diethyl 2,3-dihydro-1H-pyrrolizine-1,7-dicarboxylate |
| SMILES | CCOC(=O)c1ccn2c1C(C(=O)OCC)CC2 |
| InChI | InChI=1S/C13H17NO4/c1-3-17-12(15)9-5-7-14-8-6-10(11(9)14)13(16)18-4-2/h5,7,10H,3-4,6,8H2,1-2H3 |
| InChIKey | LIHGLELPJRJDTP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |